C19H20FNO — CID 737856
4-fluoro-N-[(1-phenylcyclopentyl)methyl]benzamide (PubChem CID 737856) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 4-fluoro-N-[(1-phenylcyclopentyl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[(1-phenylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 737856 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-fluoro-N-[(1-phenylcyclopentyl)methyl]benzamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO/c20-17-10-8-15(9-11-17)18(22)21-14-19(12-4-5-13-19)16-6-2-1-3-7-16/h1-3,6-11H,4-5,12-14H2,(H,21,22) |
| InChIKey | WFIOEMSTCIFUSL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |