C20H21FN2O3S — CID 55846765
N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 55846765) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55846765 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)NC2CC2)cc1)C1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21FN2O3S/c21-16-5-3-15(4-6-16)20(11-12-20)19(24)22-13-14-1-9-18(10-2-14)27(25,26)23-17-7-8-17/h1-6,9-10,17,23H,7-8,11-13H2,(H,22,24) |
| InChIKey | ORNLKMKRSJGZKD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |