C21H23ClN2O3S — CID 55972909
1-(3-chlorophenyl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]cyclobutane-1-carboxamide (PubChem CID 55972909) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 55972909 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]cyclobutane-1-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)NC2CC2)cc1)C1(c2cccc(Cl)c2)CCC1 |
| InChI | InChI=1S/C21H23ClN2O3S/c22-17-4-1-3-16(13-17)21(11-2-12-21)20(25)23-14-15-5-9-19(10-6-15)28(26,27)24-18-7-8-18/h1,3-6,9-10,13,18,24H,2,7-8,11-12,14H2,(H,23,25) |
| InChIKey | JFIFXFBVEMGJNW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |