C19H19ClN2O2 — CID 33097792
3-[[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]methyl]benzamide (PubChem CID 33097792) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 3-[[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]methyl]benzamide.
| Compound Name | 3-[[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 33097792 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)C2(c3cccc(Cl)c3)CCC2)c1 |
| InChI | InChI=1S/C19H19ClN2O2/c20-16-7-2-6-15(11-16)19(8-3-9-19)18(24)22-12-13-4-1-5-14(10-13)17(21)23/h1-2,4-7,10-11H,3,8-9,12H2,(H2,21,23)(H,22,24) |
| InChIKey | HRDNOWILEBYLOP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |