C18H13F3N2O — CID 113209255
1-(1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide (PubChem CID 113209255) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113209255 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C18H13F3N2O/c19-12-5-6-14(16(21)15(12)20)23-17(24)18(7-8-18)11-9-22-13-4-2-1-3-10(11)13/h1-6,9,22H,7-8H2,(H,23,24) |
| InChIKey | SAEBIIRZVWEVRO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|