C21H22N2O — CID 113209182
1-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide (PubChem CID 113209182) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113209182 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2(c3c[nH]c4ccccc34)CC2)c(C)c1 |
| InChI | InChI=1S/C21H22N2O/c1-13-10-14(2)19(15(3)11-13)23-20(24)21(8-9-21)17-12-22-18-7-5-4-6-16(17)18/h4-7,10-12,22H,8-9H2,1-3H3,(H,23,24) |
| InChIKey | ODZGZTFVBRFTER-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |