C20H20N2O — CID 113209170
N-(2,4-dimethylphenyl)-1-(1H-indol-3-yl)cyclopropane-1-carboxamide (PubChem CID 113209170) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-(1H-indol-3-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-(1H-indol-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113209170 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-(1H-indol-3-yl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3c[nH]c4ccccc34)CC2)c(C)c1 |
| InChI | InChI=1S/C20H20N2O/c1-13-7-8-17(14(2)11-13)22-19(23)20(9-10-20)16-12-21-18-6-4-3-5-15(16)18/h3-8,11-12,21H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | DUUOGXSDRCEYAI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |