C16H13BrFNO — CID 134062088
1-(3-bromophenyl)-N-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 134062088) has the molecular formula C16H13BrFNO and a molecular weight of 334.19 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134062088 |
| Molecular Formula | C16H13BrFNO |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-(3-bromophenyl)-N-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1F)C1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H13BrFNO/c17-12-5-3-4-11(10-12)16(8-9-16)15(20)19-14-7-2-1-6-13(14)18/h1-7,10H,8-9H2,(H,19,20) |
| InChIKey | DCGJACZFIRRWDO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |