C17H17FN6O3S — CID 56571773
N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-2-methyl-5-(methylsulfamoyl)benzamide (PubChem CID 56571773) has the molecular formula C17H17FN6O3S and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-2-methyl-5-(methylsulfamoyl)benzamide.
| Compound Name | N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-2-methyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56571773 |
| Molecular Formula | C17H17FN6O3S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[2-fluoro-5-(5-methyltetrazol-1-yl)phenyl]-2-methyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(C(=O)Nc2cc(-n3nnnc3C)ccc2F)c1 |
| InChI | InChI=1S/C17H17FN6O3S/c1-10-4-6-13(28(26,27)19-3)9-14(10)17(25)20-16-8-12(5-7-15(16)18)24-11(2)21-22-23-24/h4-9,19H,1-3H3,(H,20,25) |
| InChIKey | HUACSNBKDGAOTH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |