C17H17N5O3S — CID 86983152
2-methyl-5-methylsulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide (PubChem CID 86983152) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 2-methyl-5-methylsulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 86983152 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)Nc1cccc(-n2nnnc2C)c1 |
| InChI | InChI=1S/C17H17N5O3S/c1-11-7-8-15(26(3,24)25)10-16(11)17(23)18-13-5-4-6-14(9-13)22-12(2)19-20-21-22/h4-10H,1-3H3,(H,18,23) |
| InChIKey | RLIOHBDJZSMKIW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |