C22H26N6O3S — CID 55676850
4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide (PubChem CID 55676850) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55676850 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)c2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H26N6O3S/c1-16-24-25-26-28(16)20-10-6-7-18(15-20)23-22(29)17-11-13-21(14-12-17)32(30,31)27(2)19-8-4-3-5-9-19/h6-7,10-15,19H,3-5,8-9H2,1-2H3,(H,23,29) |
| InChIKey | BEHOTKALMUDTKQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |