C21H27N3O5S2 — CID 43057657
4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(methanesulfonamido)phenyl]benzamide (PubChem CID 43057657) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(methanesulfonamido)phenyl]benzamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(methanesulfonamido)phenyl]benzamide |
|---|---|
| PubChem CID | 43057657 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-[3-(methanesulfonamido)phenyl]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)Nc2cccc(NS(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H27N3O5S2/c1-24(19-9-4-3-5-10-19)31(28,29)20-13-11-16(12-14-20)21(25)22-17-7-6-8-18(15-17)23-30(2,26)27/h6-8,11-15,19,23H,3-5,9-10H2,1-2H3,(H,22,25) |
| InChIKey | HIWUUVKEVGXXII-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |