C18H19N3O4S — CID 166185447
1-N-cyclopropyl-4-N-[3-(methanesulfonamido)phenyl]benzene-1,4-dicarboxamide (PubChem CID 166185447) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N-[3-(methanesulfonamido)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopropyl-4-N-[3-(methanesulfonamido)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166185447 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-N-cyclopropyl-4-N-[3-(methanesulfonamido)phenyl]benzene-1,4-dicarboxamide |
| SMILES | CS(=O)(=O)Nc1cccc(NC(=O)c2ccc(C(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-26(24,25)21-16-4-2-3-15(11-16)20-18(23)13-7-5-12(6-8-13)17(22)19-14-9-10-14/h2-8,11,14,21H,9-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | RNINNTZUOYGECW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |