C22H28N2O5S2 — CID 26906898
N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 26906898) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 26906898 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=O)c2ccc(CS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-24(20-6-4-3-5-7-20)31(28,29)21-14-12-19(13-15-21)23-22(25)18-10-8-17(9-11-18)16-30(2,26)27/h8-15,20H,3-7,16H2,1-2H3,(H,23,25) |
| InChIKey | XCUPEZOLPBZLSH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |