C20H23NO3S2 — CID 37400585
N-(4-cyclopentylsulfanylphenyl)-4-(methylsulfonylmethyl)benzamide (PubChem CID 37400585) has the molecular formula C20H23NO3S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 37400585 |
| Molecular Formula | C20H23NO3S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2ccc(SC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C20H23NO3S2/c1-26(23,24)14-15-6-8-16(9-7-15)20(22)21-17-10-12-19(13-11-17)25-18-4-2-3-5-18/h6-13,18H,2-5,14H2,1H3,(H,21,22) |
| InChIKey | BPPPLWWDJZZTCL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |