C13H16ClNOS — CID 43700029
2-chloro-N-(4-cyclopentylsulfanylphenyl)acetamide (PubChem CID 43700029) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-chloro-N-(4-cyclopentylsulfanylphenyl)acetamide.
| Compound Name | 2-chloro-N-(4-cyclopentylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 43700029 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-chloro-N-(4-cyclopentylsulfanylphenyl)acetamide |
| SMILES | O=C(CCl)Nc1ccc(SC2CCCC2)cc1 |
| InChI | InChI=1S/C13H16ClNOS/c14-9-13(16)15-10-5-7-12(8-6-10)17-11-3-1-2-4-11/h5-8,11H,1-4,9H2,(H,15,16) |
| InChIKey | AVFXYXXPBPVENN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|