C14H21ClN2OS — CID 119293414
(2R)-2-amino-N-(4-cyclopentylsulfanylphenyl)propanamide;hydrochloride (PubChem CID 119293414) has the molecular formula C14H21ClN2OS and a molecular weight of 300.86 g/mol. Its IUPAC name is (2R)-2-amino-N-(4-cyclopentylsulfanylphenyl)propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-(4-cyclopentylsulfanylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119293414 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2R)-2-amino-N-(4-cyclopentylsulfanylphenyl)propanamide;hydrochloride |
| SMILES | C[C@@H](N)C(=O)Nc1ccc(SC2CCCC2)cc1.Cl |
| InChI | InChI=1S/C14H20N2OS.ClH/c1-10(15)14(17)16-11-6-8-13(9-7-11)18-12-4-2-3-5-12;/h6-10,12H,2-5,15H2,1H3,(H,16,17);1H/t10-;/m1./s1 |
| InChIKey | KSEZEISUEQLILW-HNCPQSOCSA-N |
| XLogP | 3.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |