C22H26N2O2S2 — CID 46423104
N-(4-cyclopentylsulfanylphenyl)-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide (PubChem CID 46423104) has the molecular formula C22H26N2O2S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 46423104 |
| Molecular Formula | C22H26N2O2S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)Nc2ccc(SC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C22H26N2O2S2/c1-16-5-4-6-18(13-16)24-22(26)15-27-14-21(25)23-17-9-11-20(12-10-17)28-19-7-2-3-8-19/h4-6,9-13,19H,2-3,7-8,14-15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | YEKIDALDLONSME-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |