C23H26N4OS2 — CID 46598314
N-(4-cyclopentylsulfanylphenyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 46598314) has the molecular formula C23H26N4OS2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 46598314 |
| Molecular Formula | C23H26N4OS2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)Nc2ccc(SC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C23H26N4OS2/c1-16-5-4-6-17(15-16)22-25-26-23(29)27(22)14-13-21(28)24-18-9-11-20(12-10-18)30-19-7-2-3-8-19/h4-6,9-12,15,19H,2-3,7-8,13-14H2,1H3,(H,24,28)(H,26,29) |
| InChIKey | KAAQOXGJOWWBDU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|