C23H27N5O3S2 — CID 55518557
3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55518557) has the molecular formula C23H27N5O3S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55518557 |
| Molecular Formula | C23H27N5O3S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C23H27N5O3S2/c1-17-7-5-8-18(15-17)22-25-26-23(32)28(22)14-11-21(29)24-19-9-6-10-20(16-19)33(30,31)27-12-3-2-4-13-27/h5-10,15-16H,2-4,11-14H2,1H3,(H,24,29)(H,26,32) |
| InChIKey | ADKMMDVLZLRNKA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|