C22H23N5O2S — CID 42279692
3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]propanamide (PubChem CID 42279692) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]propanamide.
| Compound Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 42279692 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]propanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)Nc2cccc(N3CCCC3=O)c2)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-15-7-9-16(10-8-15)21-24-25-22(30)27(21)13-11-19(28)23-17-4-2-5-18(14-17)26-12-3-6-20(26)29/h2,4-5,7-10,14H,3,6,11-13H2,1H3,(H,23,28)(H,25,30) |
| InChIKey | APPRWLLHDNPUBU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|