C21H24N4OS — CID 35019129
3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-propan-2-ylphenyl)propanamide (PubChem CID 35019129) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-propan-2-ylphenyl)propanamide.
| Compound Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 35019129 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(4-propan-2-ylphenyl)propanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H24N4OS/c1-14(2)16-8-10-18(11-9-16)22-19(26)12-13-25-20(23-24-21(25)27)17-6-4-15(3)5-7-17/h4-11,14H,12-13H2,1-3H3,(H,22,26)(H,24,27) |
| InChIKey | MRUCVCFXYPQYAH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|