C17H17N5OS — CID 35035254
3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-pyridin-2-ylpropanamide (PubChem CID 35035254) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 35035254 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-pyridin-2-ylpropanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C17H17N5OS/c1-12-5-7-13(8-6-12)16-20-21-17(24)22(16)11-9-15(23)19-14-4-2-3-10-18-14/h2-8,10H,9,11H2,1H3,(H,21,24)(H,18,19,23) |
| InChIKey | LADXFTVJJBEHHR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|