C21H19N5OS2 — CID 56549043
3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide (PubChem CID 56549043) has the molecular formula C21H19N5OS2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide.
| Compound Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 56549043 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)Nc2cccc(-c3nccs3)c2)cc1 |
| InChI | InChI=1S/C21H19N5OS2/c1-14-5-7-15(8-6-14)19-24-25-21(28)26(19)11-9-18(27)23-17-4-2-3-16(13-17)20-22-10-12-29-20/h2-8,10,12-13H,9,11H2,1H3,(H,23,27)(H,25,28) |
| InChIKey | XYYHGEJILPGOFJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|