C15H18N2O2S — CID 47353616
4-ethoxy-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide (PubChem CID 47353616) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-ethoxy-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide.
| Compound Name | 4-ethoxy-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 47353616 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-ethoxy-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide |
| SMILES | CCOCCCC(=O)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C15H18N2O2S/c1-2-19-9-4-7-14(18)17-13-6-3-5-12(11-13)15-16-8-10-20-15/h3,5-6,8,10-11H,2,4,7,9H2,1H3,(H,17,18) |
| InChIKey | APLFKKFOWNNDQV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|