C14H17N3OS — CID 62834909
3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide (PubChem CID 62834909) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide.
| Compound Name | 3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 62834909 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]propanamide |
| SMILES | CCNCCC(=O)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C14H17N3OS/c1-2-15-7-6-13(18)17-12-5-3-4-11(10-12)14-16-8-9-19-14/h3-5,8-10,15H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | OGJMVLPTFHQRMT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|