C15H19N3OS — CID 62838310
3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide (PubChem CID 62838310) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide.
| Compound Name | 3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 62838310 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-(ethylamino)-N-[3-(1,3-thiazol-2-yl)phenyl]butanamide |
| SMILES | CCNC(C)CC(=O)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C15H19N3OS/c1-3-16-11(2)9-14(19)18-13-6-4-5-12(10-13)15-17-7-8-20-15/h4-8,10-11,16H,3,9H2,1-2H3,(H,18,19) |
| InChIKey | NSOWHTLHJSHYID-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |