C22H17N5OS3 — CID 34288974
N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 34288974) has the molecular formula C22H17N5OS3 and a molecular weight of 463.61 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 34288974 |
| Molecular Formula | C22H17N5OS3 |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H17N5OS3/c28-19(10-11-27-20(25-26-22(27)29)18-9-4-12-30-18)23-15-6-3-5-14(13-15)21-24-16-7-1-2-8-17(16)31-21/h1-9,12-13H,10-11H2,(H,23,28)(H,26,29) |
| InChIKey | LMHSRHALAGAXCZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|