C24H24N4O3S — CID 32983881
N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide (PubChem CID 32983881) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
|---|---|
| PubChem CID | 32983881 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C24H24N4O3S/c29-20(11-14-28-22(30)24(27-23(28)31)12-4-1-5-13-24)25-17-8-6-7-16(15-17)21-26-18-9-2-3-10-19(18)32-21/h2-3,6-10,15H,1,4-5,11-14H2,(H,25,29)(H,27,31) |
| InChIKey | YOHFZEGMYDHPPR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|