C19H24N4O4 — CID 17446914
3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-N-ethylbenzamide (PubChem CID 17446914) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-N-ethylbenzamide.
| Compound Name | 3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 17446914 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CCN2C(=O)NC3(CCCC3)C2=O)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-2-20-16(25)13-6-5-7-14(12-13)21-15(24)8-11-23-17(26)19(22-18(23)27)9-3-4-10-19/h5-7,12H,2-4,8-11H2,1H3,(H,20,25)(H,21,24)(H,22,27) |
| InChIKey | JRQVJRGVSPXCIT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|