C21H16N2O2S — CID 78837215
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-hydroxyphenyl)acetamide (PubChem CID 78837215) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78837215 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H16N2O2S/c24-17-10-8-14(9-11-17)12-20(25)22-16-5-3-4-15(13-16)21-23-18-6-1-2-7-19(18)26-21/h1-11,13,24H,12H2,(H,22,25) |
| InChIKey | QBCWUPHOOBAUDH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |