C22H18N2O2S — CID 16911452
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3-methoxyphenyl)acetamide (PubChem CID 16911452) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16911452 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)Nc2cccc(-c3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C22H18N2O2S/c1-26-18-9-4-6-15(12-18)13-21(25)23-17-8-5-7-16(14-17)22-24-19-10-2-3-11-20(19)27-22/h2-12,14H,13H2,1H3,(H,23,25) |
| InChIKey | GOKBCOKNEXPREA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |