C23H18N2O3S2 — CID 3311571
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3,5-dimethoxyphenyl)-2-oxoethanethioamide (PubChem CID 3311571) has the molecular formula C23H18N2O3S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3,5-dimethoxyphenyl)-2-oxoethanethioamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3,5-dimethoxyphenyl)-2-oxoethanethioamide |
|---|---|
| PubChem CID | 3311571 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(3,5-dimethoxyphenyl)-2-oxoethanethioamide |
| SMILES | COc1cc(OC)cc(C(=O)C(=S)Nc2cccc(-c3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C23H18N2O3S2/c1-27-17-11-15(12-18(13-17)28-2)21(26)22(29)24-16-7-5-6-14(10-16)23-25-19-8-3-4-9-20(19)30-23/h3-13H,1-2H3,(H,24,29) |
| InChIKey | XLWJIAVZECNSOF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|