C21H21N3O2S — CID 34289832
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 34289832) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 34289832 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | O=C(CN1CCCCCC1=O)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H21N3O2S/c25-19(14-24-12-5-1-2-11-20(24)26)22-16-8-6-7-15(13-16)21-23-17-9-3-4-10-18(17)27-21/h3-4,6-10,13H,1-2,5,11-12,14H2,(H,22,25) |
| InChIKey | LAESNCPZRQRPCJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |