C19H15N5O2S3 — CID 46553213
N-[3-[[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 46553213) has the molecular formula C19H15N5O2S3 and a molecular weight of 441.56 g/mol. Its IUPAC name is N-[3-[[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46553213 |
| Molecular Formula | C19H15N5O2S3 |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[3-[[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H15N5O2S3/c25-16(11-24-17(22-23-19(24)27)14-6-2-8-28-14)20-12-4-1-5-13(10-12)21-18(26)15-7-3-9-29-15/h1-10H,11H2,(H,20,25)(H,21,26)(H,23,27) |
| InChIKey | YBHHLSPRLQUHQO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|