C20H17N5OS2 — CID 18269318
N-(4-anilinophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 18269318) has the molecular formula C20H17N5OS2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(4-anilinophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18269318 |
| Molecular Formula | C20H17N5OS2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-(4-anilinophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H17N5OS2/c26-18(13-25-19(23-24-20(25)27)17-7-4-12-28-17)22-16-10-8-15(9-11-16)21-14-5-2-1-3-6-14/h1-12,21H,13H2,(H,22,26)(H,24,27) |
| InChIKey | HAZXHMCFKLWJIF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|