C21H19N5OS2 — CID 39476748
N'-benzyl-N'-phenyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetohydrazide (PubChem CID 39476748) has the molecular formula C21H19N5OS2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N'-benzyl-N'-phenyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetohydrazide.
| Compound Name | N'-benzyl-N'-phenyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 39476748 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N'-benzyl-N'-phenyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetohydrazide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N5OS2/c27-19(15-25-20(22-23-21(25)28)18-12-7-13-29-18)24-26(17-10-5-2-6-11-17)14-16-8-3-1-4-9-16/h1-13H,14-15H2,(H,23,28)(H,24,27) |
| InChIKey | NKSYGWDMUAPSRU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|