C13H12N4O2S2 — CID 24539605
N-(furan-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 24539605) has the molecular formula C13H12N4O2S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 24539605 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)NCc1ccco1 |
| InChI | InChI=1S/C13H12N4O2S2/c18-11(14-7-9-3-1-5-19-9)8-17-12(15-16-13(17)20)10-4-2-6-21-10/h1-6H,7-8H2,(H,14,18)(H,16,20) |
| InChIKey | YFMGCGLUXDEADI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|