C21H19N5O3S2 — CID 42018215
N-[4-[[3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 42018215) has the molecular formula C21H19N5O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[4-[[3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42018215 |
| Molecular Formula | C21H19N5O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-[4-[[3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)NCc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H19N5O3S2/c27-18(9-10-26-19(24-25-21(26)30)17-4-2-12-31-17)22-13-14-5-7-15(8-6-14)23-20(28)16-3-1-11-29-16/h1-8,11-12H,9-10,13H2,(H,22,27)(H,23,28)(H,25,30) |
| InChIKey | PBMURXAVYAADPR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|