C14H13BrN4OS3 — CID 55866474
N-[(4-bromothiophen-2-yl)methyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 55866474) has the molecular formula C14H13BrN4OS3 and a molecular weight of 429.39 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 55866474 |
| Molecular Formula | C14H13BrN4OS3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H13BrN4OS3/c15-9-6-10(23-8-9)7-16-12(20)3-4-19-13(17-18-14(19)21)11-2-1-5-22-11/h1-2,5-6,8H,3-4,7H2,(H,16,20)(H,18,21) |
| InChIKey | VGCLGFFOEZEEJB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|