C17H18N4OS2 — CID 16573371
N-(4-ethylphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 16573371) has the molecular formula C17H18N4OS2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-(4-ethylphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 16573371 |
| Molecular Formula | C17H18N4OS2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-(4-ethylphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CCc1ccc(NC(=O)CCn2c(-c3cccs3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H18N4OS2/c1-2-12-5-7-13(8-6-12)18-15(22)9-10-21-16(19-20-17(21)23)14-4-3-11-24-14/h3-8,11H,2,9-10H2,1H3,(H,18,22)(H,20,23) |
| InChIKey | DWKQXCRVBSSWQL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|