C19H22N4O2S2 — CID 46652536
N-(5-tert-butyl-2-hydroxyphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 46652536) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 46652536 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)CCn2c(-c3cccs3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C19H22N4O2S2/c1-19(2,3)12-6-7-14(24)13(11-12)20-16(25)8-9-23-17(21-22-18(23)26)15-5-4-10-27-15/h4-7,10-11,24H,8-9H2,1-3H3,(H,20,25)(H,22,26) |
| InChIKey | FTZDDMDZWCEPKQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|