C18H20N6OS2 — CID 32949771
N-(5-pyrrolidin-1-yl-2-pyridinyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 32949771) has the molecular formula C18H20N6OS2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(5-pyrrolidin-1-yl-2-pyridinyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-(5-pyrrolidin-1-yl-2-pyridinyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 32949771 |
| Molecular Formula | C18H20N6OS2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(5-pyrrolidin-1-yl-2-pyridinyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)Nc1ccc(N2CCCC2)cn1 |
| InChI | InChI=1S/C18H20N6OS2/c25-16(20-15-6-5-13(12-19-15)23-8-1-2-9-23)7-10-24-17(21-22-18(24)26)14-4-3-11-27-14/h3-6,11-12H,1-2,7-10H2,(H,22,26)(H,19,20,25) |
| InChIKey | JIVUOFRBJGQJHB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|