C18H19N5OS — CID 78901118
N-(5-piperidin-1-yl-2-pyridinyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 78901118) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is N-(5-piperidin-1-yl-2-pyridinyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(5-piperidin-1-yl-2-pyridinyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78901118 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-(5-piperidin-1-yl-2-pyridinyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cn1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C18H19N5OS/c24-18(15-11-14(21-22-15)16-5-4-10-25-16)20-17-7-6-13(12-19-17)23-8-2-1-3-9-23/h4-7,10-12H,1-3,8-9H2,(H,21,22)(H,19,20,24) |
| InChIKey | FSMNRAJHJSCJEE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |