C14H15N3OS — CID 32949158
N-(5-pyrrolidin-1-yl-2-pyridinyl)thiophene-3-carboxamide (PubChem CID 32949158) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(5-pyrrolidin-1-yl-2-pyridinyl)thiophene-3-carboxamide.
| Compound Name | N-(5-pyrrolidin-1-yl-2-pyridinyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 32949158 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(5-pyrrolidin-1-yl-2-pyridinyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cn1)c1ccsc1 |
| InChI | InChI=1S/C14H15N3OS/c18-14(11-5-8-19-10-11)16-13-4-3-12(9-15-13)17-6-1-2-7-17/h3-5,8-10H,1-2,6-7H2,(H,15,16,18) |
| InChIKey | UFECWMPXPVAAHT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |