C26H30N6O2S — CID 112827563
2-N,5-N-bis(5-piperidin-1-yl-2-pyridinyl)thiophene-2,5-dicarboxamide (PubChem CID 112827563) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-N,5-N-bis(5-piperidin-1-yl-2-pyridinyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(5-piperidin-1-yl-2-pyridinyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 112827563 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-N,5-N-bis(5-piperidin-1-yl-2-pyridinyl)thiophene-2,5-dicarboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cn1)c1ccc(C(=O)Nc2ccc(N3CCCCC3)cn2)s1 |
| InChI | InChI=1S/C26H30N6O2S/c33-25(29-23-11-7-19(17-27-23)31-13-3-1-4-14-31)21-9-10-22(35-21)26(34)30-24-12-8-20(18-28-24)32-15-5-2-6-16-32/h7-12,17-18H,1-6,13-16H2,(H,27,29,33)(H,28,30,34) |
| InChIKey | GYYMPYKWKSZWEJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |