C21H24N4O — CID 78878202
2,3-dimethyl-N-(5-piperidin-1-yl-2-pyridinyl)-1H-indole-5-carboxamide (PubChem CID 78878202) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 2,3-dimethyl-N-(5-piperidin-1-yl-2-pyridinyl)-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-(5-piperidin-1-yl-2-pyridinyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 78878202 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2,3-dimethyl-N-(5-piperidin-1-yl-2-pyridinyl)-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)Nc3ccc(N4CCCCC4)cn3)cc2c1C |
| InChI | InChI=1S/C21H24N4O/c1-14-15(2)23-19-8-6-16(12-18(14)19)21(26)24-20-9-7-17(13-22-20)25-10-4-3-5-11-25/h6-9,12-13,23H,3-5,10-11H2,1-2H3,(H,22,24,26) |
| InChIKey | JCCQBXLZCUAFJR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|