C17H19N5O — CID 137255654
2,3-dimethyl-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)-1H-indole-5-carboxamide (PubChem CID 137255654) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 2,3-dimethyl-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 137255654 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2,3-dimethyl-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)Nc3cnn4c3NCCC4)cc2c1C |
| InChI | InChI=1S/C17H19N5O/c1-10-11(2)20-14-5-4-12(8-13(10)14)17(23)21-15-9-19-22-7-3-6-18-16(15)22/h4-5,8-9,18,20H,3,6-7H2,1-2H3,(H,21,23) |
| InChIKey | OJXBWWQZYZXULM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|