C17H26N4O — CID 119855685
1-amino-N-(5-piperidin-1-yl-2-pyridinyl)cyclohexane-1-carboxamide (PubChem CID 119855685) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-amino-N-(5-piperidin-1-yl-2-pyridinyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-(5-piperidin-1-yl-2-pyridinyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119855685 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-amino-N-(5-piperidin-1-yl-2-pyridinyl)cyclohexane-1-carboxamide |
| SMILES | NC1(C(=O)Nc2ccc(N3CCCCC3)cn2)CCCCC1 |
| InChI | InChI=1S/C17H26N4O/c18-17(9-3-1-4-10-17)16(22)20-15-8-7-14(13-19-15)21-11-5-2-6-12-21/h7-8,13H,1-6,9-12,18H2,(H,19,20,22) |
| InChIKey | FDJMRUKFYOWSPM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |