C18H20N6O2 — CID 86992665
5-(furan-2-yl)-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]-1H-pyrazole-3-carboxamide (PubChem CID 86992665) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86992665 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 5-(furan-2-yl)-N-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]-1H-pyrazole-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cc(-c4ccco4)[nH]n3)nc2)CC1 |
| InChI | InChI=1S/C18H20N6O2/c1-23-6-8-24(9-7-23)13-4-5-17(19-12-13)20-18(25)15-11-14(21-22-15)16-3-2-10-26-16/h2-5,10-12H,6-9H2,1H3,(H,21,22)(H,19,20,25) |
| InChIKey | BTGHTKMRWYCTQQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |